ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
Ürün Adı | 2,6-Difluoro-3-methylbenzoyl chloride |
ingilizce adı | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
Moleküler Formülü | C8H5ClF2O |
Molekül Ağırlığı | 190.5745 |
InChI | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
CAS kayıt numarası | 261763-39-7 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.356g/cm3 |
Kaynama noktası | 203.1°C at 760 mmHg |
Kırılma indisi | 1.499 |
Alevlenme noktası | 76.7°C |
Buhar basıncı | 0.282mmHg at 25°C |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |