Chemindex > 261763-39-7
ID ▼
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
| Nama produk | 2,6-Difluoro-3-methylbenzoyl chloride |
| Nama bahasa Inggris | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
| MF | C8H5ClF2O |
| Berat Molekul | 190.5745 |
| InChI | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
| CAS NO | 261763-39-7 |
| Struktur Molekul |  |
| Kepadatan | 1.356g/cm3 |
| Titik didih | 203.1°C at 760 mmHg |
| Indeks bias | 1.499 |
| Titik nyala | 76.7°C |
| Tekanan uap | 0.282mmHg at 25°C |
| Kode Risiko | R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 261763-39-7 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 