ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
اسم المنتج | 2,6-Difluoro-3-methylbenzoyl chloride |
الاسم بالانجليزية | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
الصيغة الجزيئية | C8H5ClF2O |
الوزن الجزيئي الغرامي | 190.5745 |
InChI | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
إستراتيجية المساعدة القطرية | 261763-39-7 |
بنية جزيئية | ![]() |
كثافة | 1.356g/cm3 |
نقطة الغليان | 203.1°C at 760 mmHg |
معامل الإنكسار | 1.499 |
نقطة الوميض | 76.7°C |
ضغط البخار | 0.282mmHg at 25°C |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |