ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
نام محصول | 2,6-Difluoro-3-methylbenzoyl chloride |
نام انگلیسی | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
میدان مغناطیسی | C8H5ClF2O |
وزن مولکولی | 190.5745 |
InChI | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
شماره سیایاس | 261763-39-7 |
ساختار مولکولی | ![]() |
تراکم | 1.356g/cm3 |
نقطه غلیان | 203.1°C at 760 mmHg |
ضریب شکست | 1.499 |
نقطه اشتعال | 76.7°C |
فشار بخار | 0.282mmHg at 25°C |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |