ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
שם המוצר | 2,6-Difluoro-3-methylbenzoyl chloride |
שם אנגלי | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
מולקולרית פורמולה | C8H5ClF2O |
משקל מולקולרי | 190.5745 |
InChl | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
מספר CAS | 261763-39-7 |
מבנה מולקולרי | ![]() |
צפיפות | 1.356g/cm3 |
נקודת רתיחה | 203.1°C at 760 mmHg |
משקל סגולי | 1.499 |
נקודת הבזק | 76.7°C |
לחץ אדים | 0.282mmHg at 25°C |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |