ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride |
|
| termék neve | 2,6-Difluoro-3-methylbenzoyl chloride |
| Angol név | 2,6-Difluoro-3-methylbenzoyl chloride;2,6-Difluoro-m-toluoyl chloride |
| MF | C8H5ClF2O |
| Molekulatömeg | 190.5745 |
| InChI | InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
| CAS-szám | 261763-39-7 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.356g/cm3 |
| Forráspont | 203.1°C at 760 mmHg |
| Törésmutató | 1.499 |
| Gyulladáspont | 76.7°C |
| Gőznyomás | 0.282mmHg at 25°C |
| Kockázatot kódok | R34##Causes burns.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |