ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261951-67-1 3-Fluoro-4-methylbenzylamine |
|
| Produkt-Name | 3-Fluoro-4-methylbenzylamine |
| Englischer Name | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine |
| Molekulare Formel | C8H10FN |
| Molecular Weight | 139.1701 |
| InChl | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| CAS Registry Number | 261951-67-1 |
| Molecular Structure | ![]() |
| Dichte | 1.071g/cm3 |
| Siedepunkt | 198°C at 760 mmHg |
| Brechungsindex | 1.52 |
| Flammpunkt | 82.4°C |
| Dampfdruck | 0.368mmHg at 25°C |
| Risk Codes | R34##Causes burns.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |