ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261951-67-1 3-Fluoro-4-methylbenzylamine |
|
| उत्पाद का नाम | 3-Fluoro-4-methylbenzylamine |
| अंग्रेज | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine |
| आणविक फार्मूला | C8H10FN |
| आण्विक वजन | 139.1701 |
| InChI | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| कैस रजिस्टी संख्या | 261951-67-1 |
| आणविक संरचना | ![]() |
| घनत्व | 1.071g/cm3 |
| उबलने का समय | 198°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.52 |
| फ्लैश प्वाइंट | 82.4°C |
| वाष्प का दबाव | 0.368mmHg at 25°C |
| खतरे के कोड | R34##Causes burns.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |