ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261951-67-1 3-Fluoro-4-methylbenzylamine |
|
| produktnavn | 3-Fluoro-4-methylbenzylamine |
| Engelsk navn | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine |
| Molekylær Formel | C8H10FN |
| Molekylvekt | 139.1701 |
| InChI | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| CAS-nummer | 261951-67-1 |
| Molecular Structure | ![]() |
| Tetthet | 1.071g/cm3 |
| Kokepunkt | 198°C at 760 mmHg |
| Brytningsindeks | 1.52 |
| Flammepunktet | 82.4°C |
| Damptrykk | 0.368mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |