ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261951-67-1 3-Fluoro-4-methylbenzylamine |
|
| שם המוצר | 3-Fluoro-4-methylbenzylamine |
| שם אנגלי | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine |
| מולקולרית פורמולה | C8H10FN |
| משקל מולקולרי | 139.1701 |
| InChl | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| מספר CAS | 261951-67-1 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.071g/cm3 |
| נקודת רתיחה | 198°C at 760 mmHg |
| משקל סגולי | 1.52 |
| נקודת הבזק | 82.4°C |
| לחץ אדים | 0.368mmHg at 25°C |
| סיכונים קודי | R34##Causes burns.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |