Chemindex > 261951-67-1
IT ▼
261951-67-1 3-Fluoro-4-methylbenzylamine |
|
| Nome del prodotto | 3-Fluoro-4-methylbenzylamine |
| Nome inglese | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine |
| Formula molecolare | C8H10FN |
| Peso Molecolare | 139.1701 |
| InChI | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| Numero CAS | 261951-67-1 |
| Struttura molecolare |  |
| Densità | 1.071g/cm3 |
| Punto di ebollizione | 198°C at 760 mmHg |
| Indice di rifrazione | 1.52 |
| Punto d'infiammabilità | 82.4°C |
| Pressione di vapore | 0.368mmHg at 25°C |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Il servizio di database CAS chimico è fornito da ChemIndex.com 