ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261951-67-1 3-Fluoro-4-methylbenzylamine | 
    |
| Ονομασία του προϊόντος | 3-Fluoro-4-methylbenzylamine | 
| Αγγλικό όνομα | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine | 
| MF | C8H10FN | 
| Μοριακό βάρος | 139.1701 | 
| InChI | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 | 
| CAS ΟΧΙ | 261951-67-1 | 
| Μοριακή δομή | ![]()  | 
    
| Πυκνότητα | 1.071g/cm3 | 
| Σημείο βρασμού | 198°C at 760 mmHg | 
| Δείκτης διάθλασης | 1.52 | 
| Σημείο ανάφλεξης | 82.4°C | 
| Πίεση ατμών | 0.368mmHg at 25°C | 
| Κινδύνου Κώδικες | R34##Causes burns.:; | 
    
| Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |