ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
261951-67-1 3-Fluoro-4-methylbenzylamine |
|
| Nama produk | 3-Fluoro-4-methylbenzylamine |
| Nama bahasa Inggris | 3-Fluoro-4-methylbenzylamine;1-(3-fluoro-4-methylphenyl)methanamine |
| MF | C8H10FN |
| Berat Molekul | 139.1701 |
| InChI | InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
| CAS NO | 261951-67-1 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.071g/cm3 |
| Titik didih | 198°C at 760 mmHg |
| Indeks bias | 1.52 |
| Titik nyala | 82.4°C |
| Tekanan uap | 0.368mmHg at 25°C |
| Kode Risiko | R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |