ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
| Produkt-Name | tetraiodoethylene |
| Englischer Name | tetraiodoethylene;diiodoform;tetraiodoethene |
| Molekulare Formel | C2I4 |
| Molecular Weight | 531.6393 |
| InChl | InChI=1/C2I4/c3-1(4)2(5)6 |
| CAS Registry Number | 513-92-8 |
| EINECS | 208-176-2 |
| Molecular Structure | ![]() |
| Dichte | 4.087g/cm3 |
| Schmelzpunkt | 191-193℃ |
| Siedepunkt | 288.3°C at 760 mmHg |
| Brechungsindex | 1.952 |
| Flammpunkt | 139.9°C |
| Dampfdruck | 0.00409mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |