ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
| 상품명칭 | tetraiodoethylene |
| 영문 이름 | tetraiodoethylene;diiodoform;tetraiodoethene |
| 분자식 | C2I4 |
| 분자량 | 531.6393 |
| InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
| cas번호 | 513-92-8 |
| EC번호 | 208-176-2 |
| 분자 구조 | ![]() |
| 밀도 | 4.087g/cm3 |
| 녹는 점 | 191-193℃ |
| 비등점 | 288.3°C at 760 mmHg |
| 굴절 지수 | 1.952 |
| 인화점 | 139.9°C |
| 증기압 | 0.00409mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |