ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
| produktnavn | tetraiodoethylene |
| Engelsk navn | tetraiodoethylene;diiodoform;tetraiodoethene |
| Molekylær Formel | C2I4 |
| Molekylvekt | 531.6393 |
| InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
| CAS-nummer | 513-92-8 |
| EINECS | 208-176-2 |
| Molecular Structure | ![]() |
| Tetthet | 4.087g/cm3 |
| Smeltepunkt | 191-193℃ |
| Kokepunkt | 288.3°C at 760 mmHg |
| Brytningsindeks | 1.952 |
| Flammepunktet | 139.9°C |
| Damptrykk | 0.00409mmHg at 25°C |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |