ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene | 
    |
| termék neve | tetraiodoethylene | 
| Angol név | tetraiodoethylene;diiodoform;tetraiodoethene | 
| MF | C2I4 | 
| Molekulatömeg | 531.6393 | 
| InChI | InChI=1/C2I4/c3-1(4)2(5)6 | 
| CAS-szám | 513-92-8 | 
| EINECS | 208-176-2 | 
| Molekuláris szerkezete | ![]()  | 
    
| Sűrűség | 4.087g/cm3 | 
| Olvadáspont | 191-193℃ | 
| Forráspont | 288.3°C at 760 mmHg | 
| Törésmutató | 1.952 | 
| Gyulladáspont | 139.9°C | 
| Gőznyomás | 0.00409mmHg at 25°C | 
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |