ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
| Nazwa produktu: | tetraiodoethylene |
| Angielska nazwa | tetraiodoethylene;diiodoform;tetraiodoethene |
| MF | C2I4 |
| Masie cząsteczkowej | 531.6393 |
| InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
| Nr CAS | 513-92-8 |
| EINECS | 208-176-2 |
| Struktury molekularnej | ![]() |
| Gęstość | 4.087g/cm3 |
| Temperatura topnienia | 191-193℃ |
| Temperatura wrzenia | 288.3°C at 760 mmHg |
| Współczynnik załamania | 1.952 |
| Temperatura zapłonu | 139.9°C |
| Ciśnienie pary | 0.00409mmHg at 25°C |
| Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |