ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
| Ονομασία του προϊόντος | tetraiodoethylene |
| Αγγλικό όνομα | tetraiodoethylene;diiodoform;tetraiodoethene |
| MF | C2I4 |
| Μοριακό βάρος | 531.6393 |
| InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
| CAS ΟΧΙ | 513-92-8 |
| EINECS | 208-176-2 |
| Μοριακή δομή | ![]() |
| Πυκνότητα | 4.087g/cm3 |
| Σημείο τήξης | 191-193℃ |
| Σημείο βρασμού | 288.3°C at 760 mmHg |
| Δείκτης διάθλασης | 1.952 |
| Σημείο ανάφλεξης | 139.9°C |
| Πίεση ατμών | 0.00409mmHg at 25°C |
| Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |