ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
| उत्पाद का नाम | tetraiodoethylene |
| अंग्रेज | tetraiodoethylene;diiodoform;tetraiodoethene |
| आणविक फार्मूला | C2I4 |
| आण्विक वजन | 531.6393 |
| InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
| कैस रजिस्टी संख्या | 513-92-8 |
| EINECS | 208-176-2 |
| आणविक संरचना | ![]() |
| घनत्व | 4.087g/cm3 |
| गलनांक | 191-193℃ |
| उबलने का समय | 288.3°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.952 |
| फ्लैश प्वाइंट | 139.9°C |
| वाष्प का दबाव | 0.00409mmHg at 25°C |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |