ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
Ονομασία του προϊόντος | 3-Chloro-N,N-dimethylaniline |
Αγγλικό όνομα | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
MF | C8H10ClN |
Μοριακό βάρος | 155.6247 |
InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
CAS ΟΧΙ | 6848-13-1 |
EINECS | 229-935-4 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.117g/cm3 |
Σημείο βρασμού | 232.663°C at 760 mmHg |
Δείκτης διάθλασης | 1.566 |
Σημείο ανάφλεξης | 94.512°C |
Πίεση ατμών | 0.058mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |