ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
שם המוצר | 3-Chloro-N,N-dimethylaniline |
שם אנגלי | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
מולקולרית פורמולה | C8H10ClN |
משקל מולקולרי | 155.6247 |
InChl | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
מספר CAS | 6848-13-1 |
EINECS | 229-935-4 |
מבנה מולקולרי | ![]() |
צפיפות | 1.117g/cm3 |
נקודת רתיחה | 232.663°C at 760 mmHg |
משקל סגולי | 1.566 |
נקודת הבזק | 94.512°C |
לחץ אדים | 0.058mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |