ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
Ürün Adı | 3-Chloro-N,N-dimethylaniline |
ingilizce adı | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
Moleküler Formülü | C8H10ClN |
Molekül Ağırlığı | 155.6247 |
InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
CAS kayıt numarası | 6848-13-1 |
EINECS | 229-935-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.117g/cm3 |
Kaynama noktası | 232.663°C at 760 mmHg |
Kırılma indisi | 1.566 |
Alevlenme noktası | 94.512°C |
Buhar basıncı | 0.058mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |