Chemindex > 6848-13-1
KR ▼
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
| 상품명칭 | 3-Chloro-N,N-dimethylaniline |
| 영문 이름 | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
| 분자식 | C8H10ClN |
| 분자량 | 155.6247 |
| InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| cas번호 | 6848-13-1 |
| EC번호 | 229-935-4 |
| 분자 구조 |  |
| 밀도 | 1.117g/cm3 |
| 비등점 | 232.663°C at 760 mmHg |
| 굴절 지수 | 1.566 |
| 인화점 | 94.512°C |
| 증기압 | 0.058mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 