ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
Nama produk | 3-Chloro-N,N-dimethylaniline |
Nama Inggeris | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
MF | C8H10ClN |
Berat Molekul | 155.6247 |
InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
CAS NO | 6848-13-1 |
EINECS | 229-935-4 |
Struktur Molekul | ![]() |
Kepadatan | 1.117g/cm3 |
Titik didih | 232.663°C at 760 mmHg |
Indeks bias | 1.566 |
Titik nyala | 94.512°C |
Tekanan wap | 0.058mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |