ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
उत्पाद का नाम | 3-Chloro-N,N-dimethylaniline |
अंग्रेज | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
आणविक फार्मूला | C8H10ClN |
आण्विक वजन | 155.6247 |
InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
कैस रजिस्टी संख्या | 6848-13-1 |
EINECS | 229-935-4 |
आणविक संरचना | ![]() |
घनत्व | 1.117g/cm3 |
उबलने का समय | 232.663°C at 760 mmHg |
अपवर्तक सूचकांक | 1.566 |
फ्लैश प्वाइंट | 94.512°C |
वाष्प का दबाव | 0.058mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |