Chemindex > 6848-13-1
NO ▼
6848-13-1 3-Chloro-N,N-dimethylaniline |
|
| produktnavn | 3-Chloro-N,N-dimethylaniline |
| Engelsk navn | 3-Chloro-N,N-dimethylaniline;3-Chloro-NN-dimethylaniline |
| Molekylær Formel | C8H10ClN |
| Molekylvekt | 155.6247 |
| InChI | InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| CAS-nummer | 6848-13-1 |
| EINECS | 229-935-4 |
| Molecular Structure |  |
| Tetthet | 1.117g/cm3 |
| Kokepunkt | 232.663°C at 760 mmHg |
| Brytningsindeks | 1.566 |
| Flammepunktet | 94.512°C |
| Damptrykk | 0.058mmHg at 25°C |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 