Chemindex > 151412-02-1
DE ▼
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
| Produkt-Name | 2,3,6-trifluorobenzyl bromide |
| Englischer Name | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
| Molekulare Formel | C8H8BrF |
| Molecular Weight | 203.0515 |
| InChl | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
| CAS Registry Number | 151412-02-1 |
| Molecular Structure |  |
| Dichte | 1.456g/cm3 |
| Schmelzpunkt | 114-46℃ |
| Siedepunkt | 211.6°C at 760 mmHg |
| Brechungsindex | 1.539 |
| Flammpunkt | 84.5°C |
| Dampfdruck | 0.262mmHg at 25°C |
| Risk Codes | R34##Causes burns.||R36##Irritating to eyes.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 