ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
produktnavn | 2,3,6-trifluorobenzyl bromide |
Engelsk navn | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
Molekylær Formel | C8H8BrF |
Molekylvekt | 203.0515 |
InChI | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
CAS-nummer | 151412-02-1 |
Molecular Structure | ![]() |
Tetthet | 1.456g/cm3 |
Smeltepunkt | 114-46℃ |
Kokepunkt | 211.6°C at 760 mmHg |
Brytningsindeks | 1.539 |
Flammepunktet | 84.5°C |
Damptrykk | 0.262mmHg at 25°C |
Risiko Koder | R34##Causes burns.||R36##Irritating to eyes.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |