Chemindex > 151412-02-1
SA ▼
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
| اسم المنتج | 2,3,6-trifluorobenzyl bromide |
| الاسم بالانجليزية | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
| الصيغة الجزيئية | C8H8BrF |
| الوزن الجزيئي الغرامي | 203.0515 |
| InChI | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
| إستراتيجية المساعدة القطرية | 151412-02-1 |
| بنية جزيئية |  |
| كثافة | 1.456g/cm3 |
| درجة الإنصهار | 114-46℃ |
| نقطة الغليان | 211.6°C at 760 mmHg |
| معامل الإنكسار | 1.539 |
| نقطة الوميض | 84.5°C |
| ضغط البخار | 0.262mmHg at 25°C |
| خطر المصطلحات | R34##Causes burns.||R36##Irritating to eyes.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 