ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
Ürün Adı | 2,3,6-trifluorobenzyl bromide |
ingilizce adı | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
Moleküler Formülü | C8H8BrF |
Molekül Ağırlığı | 203.0515 |
InChI | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
CAS kayıt numarası | 151412-02-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.456g/cm3 |
Ergime noktası | 114-46℃ |
Kaynama noktası | 211.6°C at 760 mmHg |
Kırılma indisi | 1.539 |
Alevlenme noktası | 84.5°C |
Buhar basıncı | 0.262mmHg at 25°C |
Risk Kodları | R34##Causes burns.||R36##Irritating to eyes.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |