ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
उत्पाद का नाम | 2,3,6-trifluorobenzyl bromide |
अंग्रेज | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
आणविक फार्मूला | C8H8BrF |
आण्विक वजन | 203.0515 |
InChI | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
कैस रजिस्टी संख्या | 151412-02-1 |
आणविक संरचना | ![]() |
घनत्व | 1.456g/cm3 |
गलनांक | 114-46℃ |
उबलने का समय | 211.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.539 |
फ्लैश प्वाइंट | 84.5°C |
वाष्प का दबाव | 0.262mmHg at 25°C |
खतरे के कोड | R34##Causes burns.||R36##Irritating to eyes.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |