ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
Nama produk | 2,3,6-trifluorobenzyl bromide |
Nama bahasa Inggris | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
MF | C8H8BrF |
Berat Molekul | 203.0515 |
InChI | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
CAS NO | 151412-02-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.456g/cm3 |
Titik lebur | 114-46℃ |
Titik didih | 211.6°C at 760 mmHg |
Indeks bias | 1.539 |
Titik nyala | 84.5°C |
Tekanan uap | 0.262mmHg at 25°C |
Kode Risiko | R34##Causes burns.||R36##Irritating to eyes.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |