Chemindex > 151412-02-1
KR ▼
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
| 상품명칭 | 2,3,6-trifluorobenzyl bromide |
| 영문 이름 | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
| 분자식 | C8H8BrF |
| 분자량 | 203.0515 |
| InChI | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
| cas번호 | 151412-02-1 |
| 분자 구조 |  |
| 밀도 | 1.456g/cm3 |
| 녹는 점 | 114-46℃ |
| 비등점 | 211.6°C at 760 mmHg |
| 굴절 지수 | 1.539 |
| 인화점 | 84.5°C |
| 증기압 | 0.262mmHg at 25°C |
| 리스크 규칙 | R34##Causes burns.||R36##Irritating to eyes.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 