ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
151412-02-1 2,3,6-trifluorobenzyl bromide |
|
שם המוצר | 2,3,6-trifluorobenzyl bromide |
שם אנגלי | 2,3,6-trifluorobenzyl bromide;alpha-Bromo-2,3,6-trifluorotoluene;2-(bromomethyl)-1,3,4-trifluorobenzene;1-(bromomethyl)-2-fluoro-3-methylbenzene |
מולקולרית פורמולה | C8H8BrF |
משקל מולקולרי | 203.0515 |
InChl | InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
מספר CAS | 151412-02-1 |
מבנה מולקולרי | ![]() |
צפיפות | 1.456g/cm3 |
נקודת ההתוך | 114-46℃ |
נקודת רתיחה | 211.6°C at 760 mmHg |
משקל סגולי | 1.539 |
נקודת הבזק | 84.5°C |
לחץ אדים | 0.262mmHg at 25°C |
סיכונים קודי | R34##Causes burns.||R36##Irritating to eyes.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |