ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2-(Chlormethyl)-5-(4-methylphenyl)-1,3,4-oxadiazol |
|
Produkt-Name | 2-(Chlormethyl)-5-(4-methylphenyl)-1,3,4-oxadiazol |
Englischer Name | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
Molekulare Formel | C10H9ClN2O |
Molecular Weight | 208.6443 |
InChl | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
CAS Registry Number | 287197-95-9 |
Molecular Structure | ![]() |
Dichte | 1.242g/cm3 |
Schmelzpunkt | 117℃ |
Siedepunkt | 327.8°C at 760 mmHg |
Brechungsindex | 1.555 |
Flammpunkt | 152°C |
Dampfdruck | 0.000378mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |