ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2- (klorometil) -5- (4-metilfenil) -1,3,4-oksadiazol |
|
Ürün Adı | 2- (klorometil) -5- (4-metilfenil) -1,3,4-oksadiazol |
Eş anlamlı | |
ingilizce adı | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
Moleküler Formülü | C10H9ClN2O |
Molekül Ağırlığı | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
CAS kayıt numarası | 287197-95-9 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.242g/cm3 |
Ergime noktası | 117℃ |
Kaynama noktası | 327.8°C at 760 mmHg |
Kırılma indisi | 1.555 |
Alevlenme noktası | 152°C |
Buhar basıncı | 0.000378mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |