ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2- (클로로 메틸) -5- (4- 메틸 페닐) -1,3,4- 옥사 디아 졸 |
|
상품명칭 | 2- (클로로 메틸) -5- (4- 메틸 페닐) -1,3,4- 옥사 디아 졸 |
영문 이름 | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
분자식 | C10H9ClN2O |
분자량 | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
cas번호 | 287197-95-9 |
분자 구조 | ![]() |
밀도 | 1.242g/cm3 |
녹는 점 | 117℃ |
비등점 | 327.8°C at 760 mmHg |
굴절 지수 | 1.555 |
인화점 | 152°C |
증기압 | 0.000378mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |