ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2- (क्लोरोमेथाइल) -5- (4-मिथाइलफेनिल) -1,3,4-ऑक्साडियाज़ोल |
|
उत्पाद का नाम | 2- (क्लोरोमेथाइल) -5- (4-मिथाइलफेनिल) -1,3,4-ऑक्साडियाज़ोल |
अंग्रेज | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
आणविक फार्मूला | C10H9ClN2O |
आण्विक वजन | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
कैस रजिस्टी संख्या | 287197-95-9 |
आणविक संरचना | ![]() |
घनत्व | 1.242g/cm3 |
गलनांक | 117℃ |
उबलने का समय | 327.8°C at 760 mmHg |
अपवर्तक सूचकांक | 1.555 |
फ्लैश प्वाइंट | 152°C |
वाष्प का दबाव | 0.000378mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |