ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2- (klorometil) -5- (4-metilfenil) -1,3,4-oksadazol |
|
Nama produk | 2- (klorometil) -5- (4-metilfenil) -1,3,4-oksadazol |
Nama bahasa Inggris | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
MF | C10H9ClN2O |
Berat Molekul | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
CAS NO | 287197-95-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.242g/cm3 |
Titik lebur | 117℃ |
Titik didih | 327.8°C at 760 mmHg |
Indeks bias | 1.555 |
Titik nyala | 152°C |
Tekanan uap | 0.000378mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |