ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2- (chloromethyl) -5- (4-methylphenyl) -1،3،4-oxadiazole؛ |
|
نام محصول | 2- (chloromethyl) -5- (4-methylphenyl) -1،3،4-oxadiazole؛ |
نام انگلیسی | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
میدان مغناطیسی | C10H9ClN2O |
وزن مولکولی | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
شماره سیایاس | 287197-95-9 |
ساختار مولکولی | ![]() |
تراکم | 1.242g/cm3 |
نقطه ذوب | 117℃ |
نقطه غلیان | 327.8°C at 760 mmHg |
ضریب شکست | 1.555 |
نقطه اشتعال | 152°C |
فشار بخار | 0.000378mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |