ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2-(klórmetil)-5-(4-metilfenil)-1,3,4-oxadiazol |
|
termék neve | 2-(klórmetil)-5-(4-metilfenil)-1,3,4-oxadiazol |
Angol név | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
MF | C10H9ClN2O |
Molekulatömeg | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
CAS-szám | 287197-95-9 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.242g/cm3 |
Olvadáspont | 117℃ |
Forráspont | 327.8°C at 760 mmHg |
Törésmutató | 1.555 |
Gyulladáspont | 152°C |
Gőznyomás | 0.000378mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |