ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287197-95-9 2- (كلورو ميثيل) -5- (4-ميثيل فينيل) -1،3،4-أوكساديازول ؛ |
|
اسم المنتج | 2- (كلورو ميثيل) -5- (4-ميثيل فينيل) -1،3،4-أوكساديازول ؛ |
الاسم بالانجليزية | 2-(chloromethyl)-5-(4-methylphenyl)-1,3,4-oxadiazole; |
الصيغة الجزيئية | C10H9ClN2O |
الوزن الجزيئي الغرامي | 208.6443 |
InChI | InChI=1/C10H9ClN2O/c1-7-2-4-8(5-3-7)10-13-12-9(6-11)14-10/h2-5H,6H2,1H3 |
إستراتيجية المساعدة القطرية | 287197-95-9 |
بنية جزيئية | ![]() |
كثافة | 1.242g/cm3 |
درجة الإنصهار | 117℃ |
نقطة الغليان | 327.8°C at 760 mmHg |
معامل الإنكسار | 1.555 |
نقطة الوميض | 152°C |
ضغط البخار | 0.000378mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |