ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 4,6-Dichlor-1H-indol-2-carbonylchlorid |
|
| Produkt-Name | 4,6-Dichlor-1H-indol-2-carbonylchlorid |
| Englischer Name | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| Molekulare Formel | C9H4Cl3NO |
| Molecular Weight | 248.4932 |
| InChl | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| CAS Registry Number | 306937-25-7 |
| Molecular Structure | ![]() |
| Dichte | 1.632g/cm3 |
| Schmelzpunkt | 173℃ |
| Siedepunkt | 404.9°C at 760 mmHg |
| Brechungsindex | 1.696 |
| Flammpunkt | 198.7°C |
| Dampfdruck | 9.1E-07mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R34##Causes burns.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |