ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 4،6-dichloro-1H-indole-2-carbonyl chloride؛ |
|
| نام محصول | 4،6-dichloro-1H-indole-2-carbonyl chloride؛ |
| نام انگلیسی | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| میدان مغناطیسی | C9H4Cl3NO |
| وزن مولکولی | 248.4932 |
| InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| شماره سیایاس | 306937-25-7 |
| ساختار مولکولی | ![]() |
| تراکم | 1.632g/cm3 |
| نقطه ذوب | 173℃ |
| نقطه غلیان | 404.9°C at 760 mmHg |
| ضریب شکست | 1.696 |
| نقطه اشتعال | 198.7°C |
| فشار بخار | 9.1E-07mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R34##Causes burns.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |