ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 4,6-डाइक्लोरो-1H-इंडोल-2-कार्बोनिल क्लोराइड |
|
| उत्पाद का नाम | 4,6-डाइक्लोरो-1H-इंडोल-2-कार्बोनिल क्लोराइड |
| अंग्रेज | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| आणविक फार्मूला | C9H4Cl3NO |
| आण्विक वजन | 248.4932 |
| InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| कैस रजिस्टी संख्या | 306937-25-7 |
| आणविक संरचना | ![]() |
| घनत्व | 1.632g/cm3 |
| गलनांक | 173℃ |
| उबलने का समय | 404.9°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.696 |
| फ्लैश प्वाइंट | 198.7°C |
| वाष्प का दबाव | 9.1E-07mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R34##Causes burns.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |