ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 cloruro di 4,6-dicloro-1H-indolo-2-carbonile |
|
| Nome del prodotto | cloruro di 4,6-dicloro-1H-indolo-2-carbonile |
| Nome inglese | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| Formula molecolare | C9H4Cl3NO |
| Peso Molecolare | 248.4932 |
| InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| Numero CAS | 306937-25-7 |
| Struttura molecolare | ![]() |
| Densità | 1.632g/cm3 |
| Punto di fusione | 173℃ |
| Punto di ebollizione | 404.9°C at 760 mmHg |
| Indice di rifrazione | 1.696 |
| Punto d'infiammabilità | 198.7°C |
| Pressione di vapore | 9.1E-07mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |