ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 4,6-dikloro-1H-indol-2-karbonil klorür |
|
| Ürün Adı | 4,6-dikloro-1H-indol-2-karbonil klorür |
| Eş anlamlı | |
| ingilizce adı | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| Moleküler Formülü | C9H4Cl3NO |
| Molekül Ağırlığı | 248.4932 |
| InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| CAS kayıt numarası | 306937-25-7 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.632g/cm3 |
| Ergime noktası | 173℃ |
| Kaynama noktası | 404.9°C at 760 mmHg |
| Kırılma indisi | 1.696 |
| Alevlenme noktası | 198.7°C |
| Buhar basıncı | 9.1E-07mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |