ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 chlorek 4,6-dichloro-1H-indolo-2-karbonylu |
|
| Nazwa produktu: | chlorek 4,6-dichloro-1H-indolo-2-karbonylu |
| Angielska nazwa | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| MF | C9H4Cl3NO |
| Masie cząsteczkowej | 248.4932 |
| InChI | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| Nr CAS | 306937-25-7 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.632g/cm3 |
| Temperatura topnienia | 173℃ |
| Temperatura wrzenia | 404.9°C at 760 mmHg |
| Współczynnik załamania | 1.696 |
| Temperatura zapłonu | 198.7°C |
| Ciśnienie pary | 9.1E-07mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R34##Causes burns.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |