ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-25-7 4,6-דיכלורו-1H-אינדול-2-קרבוניל כלוריד |
|
| שם המוצר | 4,6-דיכלורו-1H-אינדול-2-קרבוניל כלוריד |
| שם אנגלי | 4,6-dichloro-1H-indole-2-carbonyl chloride; |
| מולקולרית פורמולה | C9H4Cl3NO |
| משקל מולקולרי | 248.4932 |
| InChl | InChI=1/C9H4Cl3NO/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4/h1-3,13H |
| מספר CAS | 306937-25-7 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.632g/cm3 |
| נקודת ההתוך | 173℃ |
| נקודת רתיחה | 404.9°C at 760 mmHg |
| משקל סגולי | 1.696 |
| נקודת הבזק | 198.7°C |
| לחץ אדים | 9.1E-07mmHg at 25°C |
| Hazard סימנים | |
| סיכונים קודי | R34##Causes burns.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |